RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1879 |
| Common Name | 1-(5-Phospho-D-ribosyl)-ATP |
| Synonyms Names | Phosphoribosyl-ATP ;N1-(5-Phospho-D-ribosyl)-ATP ;1-(5-Phosphoribosyl)-ATP |
| Formula | C15H25N5O20P4 |
| Formula at pH 7.2 (Predicted) | C15H19N5O20P46- |
| Molecular Weight | 719.275 |
| Structure |  |
| SMILES | C(OP(O)(=O)OP(=O)(O)OP(O)(O)=O)C1(OC(C(O)C(O)1)n3(c2(ncn(c(=N)c2nc3)C4(OC(C(O)C(O)4)COP(O)(=O)O)))) |
| Reactions | OSR1229 OSR1457 |
| Pathways | |
|---|---|
| KEGG | rn00340 rn01100 rn01110 |
| Metacyc | HISTSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C02739 |
| ChEBI | 18263 |