RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1881 |
| Common Name | 7-Dehydrodesmosterol |
| Synonyms Names | Cholesta-5,7,24-triene-3beta-ol |
| Formula | C27H42O |
| Formula at pH 7.2 (Predicted) | C27H42O |
| Molecular Weight | 382.622 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)C1(C2(C(CC1)C3(C(CC2)C4(C(=CC=3)CC(O)CC4)(C)))(C)) |
| Reactions | OSR2583 OSR2592 OSR2625 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Database Links | |
|---|---|
| Gramene | CPD-8646 |
| KEGG | C05107 |
| ChEBI | 27910 |
| Pubchem Compound | 440558 |
| Pubchem Substance | 7533 |