RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1887 |
| Common Name | Phytyl diphosphate |
| Formula | C20H42O7P2 |
| Formula at pH 7.2 (Predicted) | C20H40O7P22- |
| Molecular Weight | 456.491 |
| Structure |  |
| SMILES | CC(=CCOP(O)(=O)OP(O)(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| Reactions | OSR1665 OSR1700 OSR2553 OSR2581 OSR2599 OSR2947 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 rn00900 rn00860 |
| Metacyc | PWY-1422 PWY-5063 |
| Database Links | |
|---|---|
| KEGG | C05427 |
| ChEBI | 18187 |
| Pubchem Compound | 14556929 |
| Pubchem Substance | 7791 |