RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1889 |
| Common Name | Tetrahydrofolyl-[Glu](2) |
| Synonyms Names | THF-L-glutamate |
| Formula | C24H30N8O9 |
| Formula at pH 7.2 (Predicted) | C24H27N8O93- |
| Molecular Weight | 574.543 |
| Structure |  |
| SMILES | C1C(NC2=C(N1)NC(=NC2=O)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| Reactions | OSR2279 |
| Pathways | |
|---|---|
| KEGG | rn00790 |
| Metacyc | PWY-3742 |
| Database Links | |
|---|---|
| Gramene | CPD-5725 |
| KEGG | C09332 |
| ChEBI | 27650 |
| Pubchem Compound | 442163 |
| Pubchem Substance | 11523 |