RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1893 |
| Common Name | 5-alpha-cholesta-8,24-dien-3-beta-ol |
| Synonyms Names | Zymosterol ;delta8,24-Cholestadien-3beta-ol ;5alpha-Cholesta-8,24-dien-3beta-ol |
| Formula | C27H44O |
| Formula at pH 7.2 (Predicted) | C27H44O |
| Molecular Weight | 384.638 |
| Structure |  |
| SMILES | O[C@H]4CC[C@@]3(/C2=C(/[C@@H]1CC[C@H]([C@H](C)CCC=C(/C)C)[C@@]1(C)CC2)CC[C@H]3C4)C; CC(C)=CCCC(C)C1(C2(C)(C(CC1)C3(=C(CC2)C4(C)(C(CC3)CC(O)CC4)))) |
| Reactions | OSR1232 OSR1257 OSR2277 OSR2586 OSR2621 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Metacyc | PWY66-341 PWY66-4 |
| Database Links | |
|---|---|
| KEGG | C05437 |
| ChEBI | 18252 |