RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1895 |
| Common Name | 5alpha-Cholesta-7,24-dien-3beta-ol |
| Formula | C27H44O |
| Formula at pH 7.2 (Predicted) | C27H44O |
| Molecular Weight | 384.638 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C)(C(CC=3)CC(O)CC4)))) |
| Reactions | OSR1232 OSR2625 OSR2626 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Metacyc | PWY66-341 PWY66-4 |
| Database Links | |
|---|---|
| KEGG | C05439 |
| ChEBI | 16290 |
| Pubchem Compound | 440670 |
| Pubchem Substance | 7801 |