RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1899 |
| Common Name | Glutathione disulfide |
| Synonyms Names | GSSG ;Oxiglutatione ;Oxidized glutathione |
| Formula | C20H32N6O12S2 |
| Formula at pH 7.2 (Predicted) | C20H30N6O12S22- |
| Molecular Weight | 612.631 |
| Structure |  |
| SMILES | C(=O)(CCC(N)C(O)=O)NC(C(=O)NCC(O)=O)CSSCC(C(=O)NCC(O)=O)NC(=O)CCC(N)C(=O)O |
| Reactions | OSR0979 OSR1258 OSR2066 OSR2126 OSR2132 OSR2366 OSR2435 OSR2560 OSR2674 |
| Pathways | |
|---|---|
| KEGG | rn00480 rn00053 rn01100 rn00590 |
| Metacyc | PWY-4081 PWY-2261 PWY-6370 GLUT-REDOX-PWY |
| Database Links | |
|---|---|
| KEGG | C00127 |
| ChEBI | 17858 |