RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1904 |
| Common Name | Tetrahydrofolyl-[Glu](n) |
| Synonyms Names | Tetrahydrofolyl-[Glu](n+1) ;THF-polyglutamate ;Tetrahydropteroyl-[gamma-Glu]n ;Tetrahydropteroyl-[gamma-Glu]n+1 |
| Formula | C19H23N7O6(C5H7NO3)n |
| Formula at pH 7.2 (Predicted) | C24H27N8O93- |
| Structure |  |
| SMILES | NC1=NC2=C(NC(CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)NC(CCC(O)=O)C(O)=O)C(O)=O)CN2)C(=O)N1 |
| Reactions | OSR1279 OSR2405 |
| Pathways | |
|---|---|
| KEGG | rn00790 |
| Database Links | |
|---|---|
| KEGG | C03541 |
| ChEBI | 28624 |
| Pubchem Compound | 442163 |
| Pubchem Substance | 6345 |