RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1905 |
| Common Name | Rutin |
| Synonyms Names | 3-[[6-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one ;Quercetin 3-rutinoside ;Rutoside ;Phytomelin |
| Formula | C27H30O16 |
| Formula at pH 7.2 (Predicted) | C27H29O16- |
| Molecular Weight | 610.518 |
| Structure |  |
| SMILES | Oc1cc(O)c2c(c1)oc(c(c2=O)OC1OC(COC2OC(C)C(C(C2O)O)O)C(C(C1O)O)O)c1ccc(c(c1)O)O |
| Reactions | OSR2141 |
| Pathways | |
|---|---|
| KEGG | rn00944 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05625 |
| ChEBI | 28527 |
| Pubchem Compound | 5280805 |
| Pubchem Substance | 7941 |