RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1907 |
| Common Name | 5-Dehydroepisterol |
| Formula | C28H44O |
| Formula at pH 7.2 (Predicted) | C28H44O |
| Molecular Weight | 396.648 |
| Structure |  |
| SMILES | CC(C)C(=C)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(=CC=3)CC(O)CC4)(C)))) |
| Reactions | OSR1268 OSR1272 OSR2628 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| Gramene | CPD-700 |
| KEGG | C15780 |
| Pubchem Compound | 10894570 |
| Pubchem Substance | 47205105 |