RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1914 |
| Common Name | DNA-Cytosines |
| Synonyms Names | DNA cytosine ;Cytosine (in DNA) ;C00856 |
| Formula | C9H14N3O7P(C5H8O5PR)n(C5H8O5PR)n |
| Formula at pH 7.2 (Predicted) | C19H26O17N3P3R22- |
| Structure |  |
| SMILES | NC1=NC(=O)N(C=C1)C2CC(O[P](O)(=O)OCC3OC(CC3O)[R])C(CO[P](O)(=O)OC4CC(OC4CO[P](O)(O)=O)[R])O2 |
| Reactions | OSR2293 |
| Pathways | |
|---|---|
| KEGG | rn00270 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00856 |
| Pubchem Substance | 4113 |