RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1916 |
| Common Name | Cholesterol |
| Synonyms Names | Cholest-5-en-3beta-ol |
| Formula | C27H46O |
| Formula at pH 7.2 (Predicted) | C27H46O |
| Molecular Weight | 386.654 |
| Structure |  |
| SMILES | CC(C)CCCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C)(C(=CC3)CC(O)CC4)))) |
| Reactions | OSR1417 OSR2550 OSR2617 OSR2620 OSR2671 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00187 |
| ChEBI | 16113 |