RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1917 |
| Common Name | Lathosterol |
| Synonyms Names | 5alpha-Cholest-7-en-3beta-ol |
| Formula | C27H46O |
| Formula at pH 7.2 (Predicted) | C27H46O |
| Molecular Weight | 386.654 |
| Structure |  |
| SMILES | CC(C)CCCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(CC=3)CC(O)CC4)(C)))) |
| Reactions | OSR1264 OSR2584 OSR2626 OSR2664 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Metacyc | PWY66-3 |
| Database Links | |
|---|---|
| Gramene | CPD-4186 |
| KEGG | C01189 |
| ChEBI | 17168 |