RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1919 |
| Common Name | Leukotriene D4 |
| Synonyms Names | LTD4 |
| Formula | C25H40N2O6S |
| Formula at pH 7.2 (Predicted) | C25H39N2O6S- |
| Molecular Weight | 496.66 |
| Structure |  |
| SMILES | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)N |
| Reactions | OSR1896 |
| Pathways | |
|---|---|
| KEGG | rn00590 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05951 |
| Pubchem Compound | 5280878 |
| Pubchem Substance | 8235 |