RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1922 |
| Common Name | delphinidin-3,5-diglucoside |
| Formula | C27H31O17 |
| Formula at pH 7.2 (Predicted) | C27H29O17- |
| Molecular Weight | 627.532 |
| Structure |  |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C=C3C(=CC(=O)C=C3OC4C(C(C(C(O4)CO)O)O)O)O2)OC5C(C(C(C(O5)CO)O)O)O |
| Reactions | OSR2202 OSR2464 OSR2844 |
| Pathways | |
|---|---|
| Metacyc | PWY-5307 |
| Database Links | |
|---|---|
| Gramene | CPD-7139 |