RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1923 |
| Common Name | delta-Tocopherol |
| Formula | C27H46O2 |
| Formula at pH 7.2 (Predicted) | C27H46O2 |
| Molecular Weight | 402.653 |
| Structure |  |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)(OC2(C(CC1)=CC(O)=CC=2C)) |
| Reactions | OSR1299 OSR2311 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C14151 |
| ChEBI | 47772 |
| Pubchem Compound | 92094 |
| Pubchem Substance | 7846963 |