RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1926 |
| Common Name | 4alpha-carboxy-5alpha-cholesta-8,24-dien-3beta-ol |
| Formula | C28H44O3 |
| Formula at pH 7.2 (Predicted) | C28H43O3- |
| Molecular Weight | 428.654 |
| Structure |  |
| SMILES | CC(=CCCC(C1CCC2C1(C)CCC1=C2CCC2C1(C)CCC(C2C(=O)O)O)C)C |
| Reactions | OSR2627 OSR2672 |
| Pathways | |
|---|---|
| Metacyc | PWY66-341 PWY66-4 |
| Database Links | |
|---|---|
| Gramene | CPD-4702 |