RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1928 |
| Common Name | 24-methylene-5-alpha-cholest-8-en-3-beta-ol |
| Synonyms Names | Fecosterol ;24-Methylene-5alpha-cholest-8-en-3beta-ol |
| Formula | C28H46O |
| Formula at pH 7.2 (Predicted) | C28H46O |
| Molecular Weight | 398.664 |
| Structure |  |
| SMILES | OC3C/C(=C/C=C1CCCC2(C)C(C(/C=C/C(C)C(C)C)C)CCC12)C(C)CC3; C=C(C(C)C)CCC(C)[CH]1(C2(C)([CH](CC1)C3(=C(CC2)C4(C)([CH](CC3)CC(O)CC4)))) |
| Reactions | OSR1294 OSR2277 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04525 |
| ChEBI | 17038 |
| Pubchem Compound | 440371 |
| Pubchem Substance | 7136 |