RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1929 |
| Common Name | Campest-4-en-3-one |
| Synonyms Names | (24R)-Ergost-4-en-3-one |
| Formula | C28H46O |
| Formula at pH 7.2 (Predicted) | C28H46O |
| Molecular Weight | 398.664 |
| Structure |  |
| SMILES | CC(C)C(C)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(CC3)=CC(=O)CC4)(C)))) |
| Reactions | OSR1319 OSR2665 OSR2693 |
| Pathways | |
|---|---|
| KEGG | rn00905 rn01100 rn01110 |
| Metacyc | PWY-2582 |
| Database Links | |
|---|---|
| Gramene | CPD-698 |
| KEGG | C15785 |
| Pubchem Compound | 11988279 |
| Pubchem Substance | 47205110 |