RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1930 |
| Common Name | Episterol |
| Formula | C28H46O |
| Formula at pH 7.2 (Predicted) | C28H46O |
| Molecular Weight | 398.664 |
| Structure |  |
| SMILES | CC(C)C(=C)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4([CH](CC=3)CC(O)CC4)(C)))) |
| Reactions | OSR1268 OSR1294 OSR1334 OSR2473 OSR2669 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15777 |
| ChEBI | 50586 |
| Pubchem Compound | 23724571 |
| Pubchem Substance | 47205103 |