RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1938 |
| Common Name | biliverdin |
| Synonyms Names | Biliverdin IX alpha |
| Formula | C33H32N4O6; C33H34N4O6 |
| Formula at pH 7.2 (Predicted) | C33H32N4O62- |
| Molecular Weight | 580.639 |
| Structure |  |
| SMILES | C=CC1=C(C)C(=CC2=NC(=Cc3[nH]c(c(c3CCC(=O)[O-])C)C=C3NC(=O)C(=C3C=C)C)C(=C2C)CCC(=O)[O-])NC1=O; C=CC1=C(C)C(=NC1=O)C=c1[nH]c(=Cc2[nH]c(c(c2CCC(=O)O)C)C=C2NC(=O)C(=C2C=C)C)c(c1C)CCC(=O)O |
| Reactions | OSR1442 OSR2846 OSR2993 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C00500 |
| ChEBI | 17033 |
| Pubchem Compound | 5280353 |
| Pubchem Substance | 3783 |