RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1941 |
| Common Name | Magnesium protoporphyrin |
| Synonyms Names | Magnesium protoporphyrin IX ;Mg-protoporphyrin IX |
| Formula | C34H32MgN4O4 |
| Formula at pH 7.2 (Predicted) | C34H30MgN4O42- |
| Molecular Weight | 584.947 |
| Structure |  |
| SMILES | CC1=C(CCC(O)=O)C2=NC1=C/C3=C(C)C(=C4C=C5/N=C(/C=C6N([Mg][N]34)C(=C2)C(=C6C)CCC(O)=O)C(=C5C)C=C)C=C |
| Reactions | OSR2308 OSR2352 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | CHLOROPHYLL-SYN |
| Database Links | |
|---|---|
| KEGG | C03516 |
| ChEBI | 15431 |
| Pubchem Compound | 440035 |
| Pubchem Substance | 6325 |