RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1944 |
| Common Name | L-Prolyl-tRNA(Pro) |
| Synonyms Names | C02702 ;L-PROLYL-TRNA(PRO) |
| Formula | C15H24NO11PR2(C5H8O6PR)n |
| Formula at pH 7.2 (Predicted) | C2H31NO17P2R3 |
| Structure |  |
| SMILES | OCC1OC(C(O)C1O[P](O)(=O)OCC2OC(C(O)C2O[P](O)(=O)OCC3OC(C(O)C3OC(=O)C4CCCN4)[R])[R])[R] |
| Reactions | OSR2544 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C02702 |
| Pubchem Substance | 5665 |