RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1945 |
| Common Name | 3alpha,7alpha-Dihydroxy-5beta-cholestan-26-al |
| Formula | C27H46O3 |
| Formula at pH 7.2 (Predicted) | C27H46O3 |
| Molecular Weight | 418.652 |
| Structure |  |
| SMILES | O=CC(CCCC(C1CCC2C1(C)CCC1C2C(O)CC2C1(C)CCC(C2)O)C)C |
| Reactions | OSR2596 OSR2623 |
| Database Links | |
|---|---|
| KEGG | C05445 |
| ChEBI | 27428 |
| Pubchem Compound | 5460041 |
| Pubchem Substance | 7807 |