RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1949 |
| Common Name | 22alpha-Hydroxy-campest-4-en-3-one |
| Synonyms Names | (22S,24R)-22-Hydroxy-ergost-4 en-3-one |
| Formula | C28H46O2 |
| Formula at pH 7.2 (Predicted) | C28H46O2 |
| Molecular Weight | 414.664 |
| Structure |  |
| SMILES | CC(C)C(C)CC(O)C(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(CC3)=CC(=O)CC4)(C)))) |
| Reactions | OSR1341 OSR2683 OSR2693 |
| Pathways | |
|---|---|
| KEGG | rn00905 rn01110 |
| Metacyc | PWY-2582 |
| Database Links | |
|---|---|
| Gramene | CPD-3945 |
| KEGG | C15796 |
| Pubchem Compound | 23724588 |
| Pubchem Substance | 47205121 |