RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1950 |
| Common Name | 4alpha-Methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol |
| Synonyms Names | delta8,14 -Sterol |
| Formula | C29H46O |
| Formula at pH 7.2 (Predicted) | C29H46O |
| Molecular Weight | 410.675 |
| Structure |  |
| SMILES | CC(C)C(=C)CCC(C)C1(C2(C)(C(=CC1)C3(=C(CC2)C4([CH](CC3)C(C)C(O)CC4)(C)))) |
| Reactions | OSR2678 OSR2775 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| KEGG | C11508 |
| ChEBI | 30109 |