RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1951 |
| Common Name | 5-Dehydroavenasterol |
| Formula | C29H46O |
| Formula at pH 7.2 (Predicted) | C29H46O |
| Molecular Weight | 410.675 |
| Structure |  |
| SMILES | CC(C)C(=CC)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(=CC=3)CC(O)CC4)(C)))) |
| Reactions | OSR1336 OSR1338 OSR1340 OSR2680 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-4126 |
| KEGG | C15783 |
| Pubchem Compound | 23724575 |
| Pubchem Substance | 47205108 |