RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1952 |
| Common Name | 4,4-Dimethyl-5alpha-cholesta-8,14,24-trien-3beta-ol |
| Formula | C29H46O |
| Formula at pH 7.2 (Predicted) | C29H46O |
| Molecular Weight | 410.675 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)C1(C2(C)(C(=CC1)C3(=C(CC2)C4(C)(C(CC3)C(C)(C)C(O)CC4)))) |
| Reactions | OSR2676 OSR2768 OSR2777 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Database Links | |
|---|---|
| KEGG | C11455 |
| ChEBI | 17813 |
| Pubchem Compound | 443212 |
| Pubchem Substance | 13626 |