RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1953 |
| Common Name | 2-Phytyl-1,4-naphthoquinone |
| Synonyms Names | Demethylphylloquinone |
| Formula | C30H44O2 |
| Formula at pH 7.2 (Predicted) | C30H44O2 |
| Molecular Weight | 436.669 |
| Structure |  |
| SMILES | CC(CCCC(C)CCCC(C)C)CCCC(C)=CCC1(C(=O)C2(=C(C(=O)C=1)C=CC=C2)) |
| Reactions | OSR1700 OSR2324 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-6947 |
| KEGG | C13309 |
| Pubchem Compound | 11954010 |
| Pubchem Substance | 586053 |