RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1958 |
| Common Name | 3alpha,7alpha-Dihydroxy-5beta-cholestanate |
| Synonyms Names | 3alpha,7alpha-Dihydroxy-5beta-cholestanoate |
| Formula | C27H46O4 |
| Formula at pH 7.2 (Predicted) | C27H45O4- |
| Molecular Weight | 434.652 |
| Structure |  |
| SMILES | OC1CCC2(C(C1)CC(C1C2CCC2(C1CCC2C(CCCC(C(=O)O)C)C)C)O)C |
| Reactions | OSR2623 |
| Database Links | |
|---|---|
| KEGG | C04554 |
| ChEBI | 16577 |
| Pubchem Compound | 440384 |
| Pubchem Substance | 7159 |