RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1961 |
| Common Name | Campesterol |
| Formula | C28H48O |
| Formula at pH 7.2 (Predicted) | C28H48O |
| Molecular Weight | 400.68 |
| Structure |  |
| SMILES | CC(C)C(C)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(=CC3)CC(O)CC4)(C)))) |
| Reactions | OSR1329 OSR1345 OSR2655 OSR2670 OSR2722 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 rn00905 |
| Metacyc | PWY-2582 |
| Database Links | |
|---|---|
| Gramene | CPD-707 |
| KEGG | C01789 |
| ChEBI | 28623 |
| Pubchem Compound | 173183 |
| Pubchem Substance | 4917 |