RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1966 |
| Common Name | 4alpha-formyl-4beta-methyl-5alpha-cholesta-8,24-dien-3beta-ol |
| Formula | C29H46O2 |
| Formula at pH 7.2 (Predicted) | C29H46O2 |
| Molecular Weight | 426.681 |
| Structure |  |
| SMILES | O=CC1(C)C(O)CCC2(C1CCC1=C2CCC2(C1CCC2C(CCC=C(C)C)C)C)C |
| Reactions | OSR2727 OSR2734 |
| Pathways | |
|---|---|
| Metacyc | PWY66-341 PWY66-4 |
| Database Links | |
|---|---|
| Gramene | CPD-4576 |