RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1972 |
| Common Name | Protochlorophyllide |
| Formula | C35H32MgN4O5 |
| Formula at pH 7.2 (Predicted) | C35H32MgN4O5 |
| Molecular Weight | 612.957 |
| Structure |  |
| SMILES | CCC8(C3(=N7([Mg]59(n2(c1(=C(C(C(=O)OC)C(=O)c1c(C)c2=C3)C4(=N(C(C(C)=C4CCC(=O)O)=Cc6(n5c(c(C=C)c(C)6)C=C7C(C)=8))9))))))) |
| Reactions | OSR2679 OSR2696 OSR2960 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C02880 |
| ChEBI | 16673 |