RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1974 |
| Common Name | 3-Dehydroteasterone |
| Formula | C28H46O4 |
| Formula at pH 7.2 (Predicted) | C28H46O4 |
| Molecular Weight | 446.662 |
| Structure |  |
| SMILES | O=C1CCC2(C(C1)C(=O)CC1C2CCC2(C1CCC2C(C(C(C(C(C)C)C)O)O)C)C)C |
| Reactions | OSR1385 |
| Pathways | |
|---|---|
| KEGG | rn00905 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15792 |
| Pubchem Compound | 23724584 |
| Pubchem Substance | 47205117 |