RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1984 |
| Common Name | 24-Methylenelophenol |
| Synonyms Names | 4-alpha-Methyl-5-alpha-ergosta-7,24-dien-3-beta-ol |
| Formula | C29H48O |
| Formula at pH 7.2 (Predicted) | C29H48O |
| Molecular Weight | 412.691 |
| Structure |  |
| SMILES | CC(C)C(=C)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4([CH](CC=3)C(C)C(O)CC4)(C)))) |
| Reactions | OSR1334 OSR1358 OSR2473 OSR2845 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| Gramene | CPD-4101 |
| KEGG | C11522 |
| ChEBI | 29107 |
| Pubchem Compound | 443245 |
| Pubchem Substance | 13690 |