RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1985 |
| Common Name | Stigmasterol |
| Formula | C29H48O |
| Formula at pH 7.2 (Predicted) | C29H48O |
| Molecular Weight | 412.691 |
| Structure |  |
| SMILES | CC(C)C(CC)C=CC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(=CC3)CC(O)CC4)(C)))) |
| Reactions | OSR1384 OSR2705 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-4162 |
| KEGG | C05442 |
| ChEBI | 28824 |
| Pubchem Compound | 5280794 |
| Pubchem Substance | 7804 |