RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1996 |
| Common Name | divinylchlorophyllide a |
| Synonyms Names | Divinyl chlorophyllide a |
| Formula | C35H32MgN4O5 |
| Formula at pH 7.2 (Predicted) | C35H36MgN4O5 |
| Molecular Weight | 612.967 |
| Structure |  |
| SMILES | COC(=O)C1C2=C3C(CCC(=O)O)C(C4N3[Mg]35n6c2c(C1=O)c(c6C=C1N3C(C=c2n5c(=C4)c(c2C=C)C)C(C1C=C)C)C)C; COC(=O)C1C(=O)C2=C(C)C/3=C/C4=NC(=C/C5=C(C=C)C(=C6C=C7/N=C(C(CCC(O)=O)C7C)C1=C2N3[Mg][N]56)C)C(=C4C=C)C |
| Reactions | OSR2682 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01110 |
| Database Links | |
|---|---|
| KEGG | C11832 |
| ChEBI | 38259 |
| Pubchem Compound | 443431 |
| Pubchem Substance | 13996 |