RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1997 |
| Common Name | Cathasterone |
| Formula | C28H48O3 |
| Formula at pH 7.2 (Predicted) | C28H48O3 |
| Molecular Weight | 432.679 |
| Structure |  |
| SMILES | OC1CCC2(C(C1)C(=O)CC1C2CCC2(C1CCC2C(C(CC(C(C)C)C)O)C)C)C |
| Reactions | OSR2739 |
| Pathways | |
|---|---|
| KEGG | rn00905 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15790 |
| Pubchem Compound | 23724582 |
| Pubchem Substance | 47205115 |