RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2004 |
| Common Name | (3Z)-Phytochromobilin |
| Formula | C33H36N4O6 |
| Formula at pH 7.2 (Predicted) | C33H34N4O62- |
| Molecular Weight | 584.662 |
| Structure |  |
| SMILES | CC=C1C(=Cc2[nH]c(c(c2C)CCC(=O)O)C=c2[nH]c(=CC3=NC(=O)C(=C3C)C=C)c(c2CCC(=O)O)C)NC(=O)C1C |
| Reactions | OSR2846 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C05913 |
| ChEBI | 15619 |
| Pubchem Compound | 5280865 |
| Pubchem Substance | 8201 |