RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2005 |
| Common Name | 13(1)-Hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester |
| Synonyms Names | 13(1)-Hydroxy-Mg-protoporphyrin IX 13-monomethyl ester ;131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester |
| Formula | C35H34MgN4O5 |
| Formula at pH 7.2 (Predicted) | C35H34MgN4O5 |
| Molecular Weight | 614.973 |
| Structure |  |
| SMILES | Cc6(c(C(O)CC(=O)OC)c1(n7([Mg]35(n4(c(C=C2(C(C)=C(C(C=1)=N23)CCC(O)=O))c(C)c(C=C)c4C=C8(N5=C(C=c67)C(C=C)=C(C)8)))))) |
| Reactions | OSR2741 OSR2749 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C11829 |
| ChEBI | 15434 |
| Pubchem Compound | 443425 |
| Pubchem Substance | 13993 |