RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2006 |
| Common Name | Chlorophyllide |
| Synonyms Names | Chlorophyllide a ;chlorophyllide a |
| Formula | C35H34MgN4O5 |
| Formula at pH 7.2 (Predicted) | C35H32MgN4O52- |
| Molecular Weight | 614.973 |
| Structure |  |
| SMILES | CCC1=C(C)C/2=C/C3=C(C=C)C(=C4C=C5/N=C(C(CCC(O)=O)C5C)C6=C7N([Mg][N]34)C(=C/C1=N2)C(=C7C(=O)C6C(=O)OC)C)C |
| Reactions | OSR1418 OSR2505 OSR2533 OSR2539 OSR2696 OSR2745 OSR2750 OSR2759 OSR2762 OSR2947 OSR2960 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5098 PWY-5086 PWY-5068 |
| Database Links | |
|---|---|
| KEGG | C02139 |
| ChEBI | 16900 |