RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2007 |
| Common Name | Dehydrodolichol diphosphate |
| Synonyms Names | Dehydrodolichyl diphosphate |
| Formula | C20H36O7P2(C5H8)n |
| Formula at pH 7.2 (Predicted) | C25H42O7P22- |
| Structure |  |
| SMILES | CC(=CCCC(=CCOP(=O)(OP(=O)(O)O)O)C)CCC=C(CCC=C(CCC=C(C)C)C)C |
| Reactions | OSR1506 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05859 |
| Pubchem Compound | 24892764 |
| Pubchem Substance | 8152 |