RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2008 |
| Common Name | Dephospho-CoA |
| Synonyms Names | Dephosphocoenzyme A |
| Formula | C21H35N7O13P2S |
| Formula at pH 7.2 (Predicted) | C21H33N7O13P2S2- |
| Molecular Weight | 687.554 |
| Structure |  |
| SMILES | CC(C)(C(O)C(=O)NCCC(=O)NCCS)COP(=O)(O)OP(=O)(O)OCC1(OC(C(O)C1O)n2(c3(c(nc2)c(N)ncn3))) |
| Reactions | OSR1689 OSR2341 |
| Pathways | |
|---|---|
| KEGG | rn00770 rn01100 |
| Metacyc | COA-PWY |
| Database Links | |
|---|---|
| KEGG | C00882 |
| ChEBI | 15468 |