RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2009 |
| Common Name | chlorophyllide b |
| Formula | C35H32MgN4O6 |
| Formula at pH 7.2 (Predicted) | C35H32MgN4O6 |
| Molecular Weight | 628.966 |
| Structure |  |
| SMILES | COC(=O)C1C2=c3c(C1=O)c(c1=Cc4n5[Mg]6([N]7=C2C(CCC(=O)O)C(C7=Cc2n6c(C=c5c(c4CC)C=O)c(c2C)C=C)C)n31)C; CCC1=C(C=O)C/2=C/C3=C(C=C)C(=C4C=C5/N=C(C(CCC(O)=O)C5C)C6=C7N([Mg][N]34)C(=C/C1=N2)C(=C7C(=O)C6C(=O)OC)C)C |
| Reactions | OSR2510 OSR2599 OSR2644 OSR2698 OSR2720 OSR2750 OSR2763 OSR2965 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5068 |
| Database Links | |
|---|---|
| Gramene | CPD-7014 |
| KEGG | C16541 |
| Pubchem Compound | 15775275 |
| Pubchem Substance | 51090870 |