RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2010 |
| Common Name | Squalene |
| Synonyms Names | Spinacene ;Supraene |
| Formula | C30H50 |
| Formula at pH 7.2 (Predicted) | C30H50 |
| Molecular Weight | 410.718 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
| Reactions | OSR1504 OSR2612 OSR2771 OSR2812 |
| Pathways | |
|---|---|
| KEGG | rn01100 rn00909 rn01110 |
| Metacyc | PWY-2541 PWY66-3 PWY66-341 PWY66-4 |
| Database Links | |
|---|---|
| KEGG | C00751 |
| ChEBI | 15440 |