RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2013 |
| Common Name | 4alpha-carboxy-4beta-methyl-5alpha-cholesta-8-en-3beta-ol |
| Formula | C29H48O3 |
| Formula at pH 7.2 (Predicted) | C29H47O3- |
| Molecular Weight | 444.696 |
| Structure |  |
| SMILES | CC(CCCC(C1CCC2C1(C)CCC1=C2CCC2C1(C)CCC(C2(C)C(=O)O)O)C)C |
| Reactions | OSR2704 OSR2754 |
| Pathways | |
|---|---|
| Metacyc | PWY66-3 |
| Database Links | |
|---|---|
| Gramene | CPD-8613 |