RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2014 |
| Common Name | Sitosterol |
| Synonyms Names | beta-Sitosterol |
| Formula | C29H50O |
| Formula at pH 7.2 (Predicted) | C29H50O |
| Molecular Weight | 414.707 |
| Structure |  |
| SMILES | CC(C)C(CC)CCC(C)C1(C2(C)(C(CC1)C3(C(CC2)C4(C(=CC3)CC(O)CC4)(C)))) |
| Reactions | OSR1384 OSR1390 OSR2705 OSR2719 OSR2764 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-4143 |
| KEGG | C01753 |
| ChEBI | 27693 |
| Pubchem Compound | 222284 |
| Pubchem Substance | 4886 |