RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2015 |
| Common Name | 4,4-Dimethyl-5alpha-cholesta-8-en-3beta-ol |
| Formula | C29H50O |
| Formula at pH 7.2 (Predicted) | C29H50O |
| Molecular Weight | 414.707 |
| Structure |  |
| SMILES | CC(C)CCCC(C)C1(C2(C(CC1)C3(=C(CC2)C4(C(CC3)C(C)(C)C(O)CC4)(C)))(C)) |
| Reactions | OSR2703 OSR2711 OSR2765 |
| Pathways | |
|---|---|
| KEGG | rn00100 |
| Metacyc | PWY66-3 |
| Database Links | |
|---|---|
| Gramene | CPD-8610 |
| KEGG | C15915 |
| Pubchem Compound | 23724604 |
| Pubchem Substance | 47205233 |