RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2018 |
| Common Name | Pheophorbide a |
| Synonyms Names | pheophorbide a |
| Formula | C35H36N4O5 |
| Formula at pH 7.2 (Predicted) | C35H34N4O52- |
| Molecular Weight | 592.684 |
| Structure |  |
| SMILES | CCC1=C(C)C2=CC3=C(C=C)C(=C([NH]3)C=C4N=C(C(CCC(O)=O)C4C)C5=C6[NH]C(=CC1=N2)C(=C6C(=O)C5C(=O)OC)C)C |
| Reactions | OSR1418 OSR2513 OSR2773 OSR2893 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-7061 |
| KEGG | C18021 |
| Pubchem Compound | 5323510 |
| Pubchem Substance | 96024241 |