RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2020 |
| Common Name | Bacteriochlorophyllide b |
| Formula | C35H34MgN4O6 |
| Formula at pH 7.2 (Predicted) | C35H34N4O6 |
| Molecular Weight | 630.973 |
| Structure |  |
| SMILES | COC(=O)C1C(=O)c2c3=C1C1=NC(=Cc4[n-]c(c(c4C)C(=O)C)C=C4N=C(C=c(c2C)[n-]3)C(=CC)C4C)C(C1CCC(=O)O)C.[Mg2+] |
| Reactions | OSR2995 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C18156 |
| Pubchem Compound | 46174061 |
| Pubchem Substance | 96024373 |